C18H20F3N7O2 — CID 137049104
2-[5-methyl-4-[3-methyl-4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 137049104) has the molecular formula C18H20F3N7O2 and a molecular weight of 423.40 g/mol. Its IUPAC name is 2-[5-methyl-4-[3-methyl-4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[5-methyl-4-[3-methyl-4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 137049104 |
| Molecular Formula | C18H20F3N7O2 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-[5-methyl-4-[3-methyl-4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1c(C(=O)N2CCN(CC(F)(F)F)C(C)C2)cnn1-c1nn2cccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H20F3N7O2/c1-11-9-25(6-7-26(11)10-18(19,20)21)16(30)13-8-22-28(12(13)2)17-23-15(29)14-4-3-5-27(14)24-17/h3-5,8,11H,6-7,9-10H2,1-2H3,(H,23,24,29) |
| InChIKey | QUDUQTUDEHQDST-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 91.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |