C21H20ClN7O2 — CID 137049573
2-[4-[4-(2-chloro-3-pyridinyl)piperidine-1-carbonyl]-5-methylpyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 137049573) has the molecular formula C21H20ClN7O2 and a molecular weight of 437.89 g/mol. Its IUPAC name is 2-[4-[4-(2-chloro-3-pyridinyl)piperidine-1-carbonyl]-5-methylpyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[4-[4-(2-chloro-3-pyridinyl)piperidine-1-carbonyl]-5-methylpyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 137049573 |
| Molecular Formula | C21H20ClN7O2 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[4-[4-(2-chloro-3-pyridinyl)piperidine-1-carbonyl]-5-methylpyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1c(C(=O)N2CCC(c3cccnc3Cl)CC2)cnn1-c1nn2cccc2c(=O)[nH]1 |
| InChI | InChI=1S/C21H20ClN7O2/c1-13-16(12-24-29(13)21-25-19(30)17-5-3-9-28(17)26-21)20(31)27-10-6-14(7-11-27)15-4-2-8-23-18(15)22/h2-5,8-9,12,14H,6-7,10-11H2,1H3,(H,25,26,30) |
| InChIKey | IRUHFBWQXSBADD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|