C20H23F3N6O3 — CID 137049704
2-[5-methyl-4-[4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 137049704) has the molecular formula C20H23F3N6O3 and a molecular weight of 452.44 g/mol. Its IUPAC name is 2-[5-methyl-4-[4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[5-methyl-4-[4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 137049704 |
| Molecular Formula | C20H23F3N6O3 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-[5-methyl-4-[4-(1,1,1-trifluoro-2-hydroxybutan-2-yl)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | CCC(O)(C1CCN(C(=O)c2cnn(-c3nn4cccc4c(=O)[nH]3)c2C)CC1)C(F)(F)F |
| InChI | InChI=1S/C20H23F3N6O3/c1-3-19(32,20(21,22)23)13-6-9-27(10-7-13)17(31)14-11-24-29(12(14)2)18-25-16(30)15-5-4-8-28(15)26-18/h4-5,8,11,13,32H,3,6-7,9-10H2,1-2H3,(H,25,26,30) |
| InChIKey | MFFFQNABZRGATB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |