C20H21F3N6O3 — CID 137049815
2-[5-methyl-4-[4-(4,4,4-trifluorobutanoyl)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 137049815) has the molecular formula C20H21F3N6O3 and a molecular weight of 450.42 g/mol. Its IUPAC name is 2-[5-methyl-4-[4-(4,4,4-trifluorobutanoyl)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[5-methyl-4-[4-(4,4,4-trifluorobutanoyl)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 137049815 |
| Molecular Formula | C20H21F3N6O3 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[5-methyl-4-[4-(4,4,4-trifluorobutanoyl)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1c(C(=O)N2CCC(C(=O)CCC(F)(F)F)CC2)cnn1-c1nn2cccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H21F3N6O3/c1-12-14(11-24-29(12)19-25-17(31)15-3-2-8-28(15)26-19)18(32)27-9-5-13(6-10-27)16(30)4-7-20(21,22)23/h2-3,8,11,13H,4-7,9-10H2,1H3,(H,25,26,31) |
| InChIKey | PYCFKZZRXNOQOW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |