C31H21N3O — CID 137052789
7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]quinolin-8-ol (PubChem CID 137052789) has the molecular formula C31H21N3O and a molecular weight of 451.53 g/mol. Its IUPAC name is 7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]quinolin-8-ol.
| Compound Name | 7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]quinolin-8-ol |
|---|---|
| PubChem CID | 137052789 |
| Molecular Formula | C31H21N3O |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]quinolin-8-ol |
| SMILES | Oc1c(-c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)ccc2cccnc12 |
| InChI | InChI=1S/C31H21N3O/c35-30-26(18-17-24-12-7-19-32-29(24)30)21-13-15-23(16-14-21)28-20-27(22-8-3-1-4-9-22)33-31(34-28)25-10-5-2-6-11-25/h1-20,35H |
| InChIKey | SCOKHAKPKDVIKN-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |