About 5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine
5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine (PubChem CID 137053043) has the molecular formula C19H35N3
and a molecular weight of 305.51 g/mol. Its IUPAC name is 5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine.
Molecular Properties
| Compound Name | 5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine |
| PubChem CID | 137053043 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | 5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine |
| SMILES | CCCCCC/N=C1\N/C(=N/CCCCCC)CC=C1CC |
| InChI | InChI=1S/C19H35N3/c1-4-7-9-11-15-20-18-14-13-17(6-3)19(22-18)21-16-12-10-8-5-2/h13H,4-12,14-16H2,1-3H3,(H,20,21,22) |
| InChIKey | XBKDNNNPESCRLY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine?
The IUPAC name of 5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine (CID 137053043) is 5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine.
What is the SMILES notation for 5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine?
The canonical SMILES for 5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine is CCCCCC/N=C1\N/C(=N/CCCCCC)CC=C1CC.
What is the InChIKey of 5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine?
The InChIKey is XBKDNNNPESCRLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35N3/c1-4-7-9-11-15-20-18-14-13-17(6-3)19(22-18)21-16-12-10-8-5-2/h13H,4-12,14-16H2,1-3H3,(H,20,21,22).
What are the key properties of 5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine?
5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine has a molecular weight of 305.51 g/mol, XLogP of 5.27, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-N,6-N-dihexyl-3H-pyridine-2,6-diimine is sourced from PubChem (CID 137053043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).