C15H17NO7S — CID 137053598
(4S)-2-[4-[2-(carboxymethoxy)ethoxy]-2-hydroxyphenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid (PubChem CID 137053598) has the molecular formula C15H17NO7S and a molecular weight of 355.37 g/mol. Its IUPAC name is (4S)-2-[4-[2-(carboxymethoxy)ethoxy]-2-hydroxyphenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-[4-[2-(carboxymethoxy)ethoxy]-2-hydroxyphenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 137053598 |
| Molecular Formula | C15H17NO7S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (4S)-2-[4-[2-(carboxymethoxy)ethoxy]-2-hydroxyphenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
| SMILES | C[C@]1(C(=O)O)CSC(c2ccc(OCCOCC(=O)O)cc2O)=N1 |
| InChI | InChI=1S/C15H17NO7S/c1-15(14(20)21)8-24-13(16-15)10-3-2-9(6-11(10)17)23-5-4-22-7-12(18)19/h2-3,6,17H,4-5,7-8H2,1H3,(H,18,19)(H,20,21)/t15-/m1/s1 |
| InChIKey | KRSLJHYDRSDJJM-OAHLLOKOSA-N |
| XLogP | 1.21 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|