About 4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol
4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol (PubChem CID 137053648) has the molecular formula C23H19F3N4O
and a molecular weight of 424.43 g/mol. Its IUPAC name is 4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol.
Molecular Properties
| Compound Name | 4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol |
| PubChem CID | 137053648 |
| Molecular Formula | C23H19F3N4O |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol |
| SMILES | Oc1ccc(-c2c(-c3ccc(F)cc3)nc3c(N4CCC(F)(F)CC4)nccn23)cc1 |
| InChI | InChI=1S/C23H19F3N4O/c24-17-5-1-15(2-6-17)19-20(16-3-7-18(31)8-4-16)30-14-11-27-21(22(30)28-19)29-12-9-23(25,26)10-13-29/h1-8,11,14,31H,9-10,12-13H2 |
| InChIKey | ZCIKENQNSIXWGB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol?
The IUPAC name of 4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol (CID 137053648) is 4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol.
What is the SMILES notation for 4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol?
The canonical SMILES for 4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol is Oc1ccc(-c2c(-c3ccc(F)cc3)nc3c(N4CCC(F)(F)CC4)nccn23)cc1.
What is the InChIKey of 4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol?
The InChIKey is ZCIKENQNSIXWGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19F3N4O/c24-17-5-1-15(2-6-17)19-20(16-3-7-18(31)8-4-16)30-14-11-27-21(22(30)28-19)29-12-9-23(25,26)10-13-29/h1-8,11,14,31H,9-10,12-13H2.
What are the key properties of 4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol?
4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol has a molecular weight of 424.43 g/mol, XLogP of 5.14, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[8-(4,4-difluoropiperidin-1-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]phenol is sourced from PubChem (CID 137053648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).