C27H28N6O6 — CID 137053997
tert-butyl 4-[10-[(3-nitrobenzoyl)amino]-2-oxo-1H-pyrimido[1,2-b]indazol-4-yl]piperidine-1-carboxylate (PubChem CID 137053997) has the molecular formula C27H28N6O6 and a molecular weight of 532.56 g/mol. Its IUPAC name is tert-butyl 4-[10-[(3-nitrobenzoyl)amino]-2-oxo-1H-pyrimido[1,2-b]indazol-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[10-[(3-nitrobenzoyl)amino]-2-oxo-1H-pyrimido[1,2-b]indazol-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137053997 |
| Molecular Formula | C27H28N6O6 |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | tert-butyl 4-[10-[(3-nitrobenzoyl)amino]-2-oxo-1H-pyrimido[1,2-b]indazol-4-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(=O)[nH]c3c4c(NC(=O)c5cccc([N+](=O)[O-])c5)cccc4nn23)CC1 |
| InChI | InChI=1S/C27H28N6O6/c1-27(2,3)39-26(36)31-12-10-16(11-13-31)21-15-22(34)29-24-23-19(8-5-9-20(23)30-32(21)24)28-25(35)17-6-4-7-18(14-17)33(37)38/h4-9,14-16H,10-13H2,1-3H3,(H,28,35)(H,29,34) |
| InChIKey | XJQYRNCQROOHIO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|