C50H31F5N4O6 — CID 137054086
[3-[10,20-bis(3-acetyloxyphenyl)-15-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl] acetate (PubChem CID 137054086) has the molecular formula C50H31F5N4O6 and a molecular weight of 878.81 g/mol. Its IUPAC name is [3-[10,20-bis(3-acetyloxyphenyl)-15-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl] acetate.
| Compound Name | [3-[10,20-bis(3-acetyloxyphenyl)-15-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 137054086 |
| Molecular Formula | C50H31F5N4O6 |
| Molecular Weight | 878.81 g/mol |
| Exact Mass | 878.22 |
| IUPAC Name | [3-[10,20-bis(3-acetyloxyphenyl)-15-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(-c2c3nc(c(-c4cccc(OC(C)=O)c4)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4nc(c(-c5cccc(OC(C)=O)c5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C50H31F5N4O6/c1-24(60)63-30-10-4-7-27(21-30)41-33-13-15-35(56-33)42(28-8-5-11-31(22-28)64-25(2)61)37-17-19-39(58-37)44(45-46(51)48(53)50(55)49(54)47(45)52)40-20-18-38(59-40)43(36-16-14-34(41)57-36)29-9-6-12-32(23-29)65-26(3)62/h4-23,56,59H,1-3H3/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39+,44-40+ |
| InChIKey | CUGGXYMLFMLMBT-JHFQPPSTSA-N |
| XLogP | 11.80 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.81 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|