C28H30N10O3 — CID 137054277
2-[5-[5-[amino(morpholine-4-carbonyl)amino]-3-pyridinyl]-2H-pyrazolo[3,4-b]pyridin-3-yl]-N,N-diethyl-1H-benzimidazole-4-carboxamide (PubChem CID 137054277) has the molecular formula C28H30N10O3 and a molecular weight of 554.62 g/mol. Its IUPAC name is 2-[5-[5-[amino(morpholine-4-carbonyl)amino]-3-pyridinyl]-2H-pyrazolo[3,4-b]pyridin-3-yl]-N,N-diethyl-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-[5-[5-[amino(morpholine-4-carbonyl)amino]-3-pyridinyl]-2H-pyrazolo[3,4-b]pyridin-3-yl]-N,N-diethyl-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 137054277 |
| Molecular Formula | C28H30N10O3 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 2-[5-[5-[amino(morpholine-4-carbonyl)amino]-3-pyridinyl]-2H-pyrazolo[3,4-b]pyridin-3-yl]-N,N-diethyl-1H-benzimidazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cccc2[nH]c(-c3[nH]nc4ncc(-c5cncc(N(N)C(=O)N6CCOCC6)c5)cc34)nc12 |
| InChI | InChI=1S/C28H30N10O3/c1-3-36(4-2)27(39)20-6-5-7-22-23(20)33-26(32-22)24-21-13-18(15-31-25(21)35-34-24)17-12-19(16-30-14-17)38(29)28(40)37-8-10-41-11-9-37/h5-7,12-16H,3-4,8-11,29H2,1-2H3,(H,32,33)(H,31,34,35) |
| InChIKey | FLXZTPJEKHHUIR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 162.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|