C22H27ClFN6O7PS — CID 137058153
propan-2-yl 2-[[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-chloro-3-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 137058153) has the molecular formula C22H27ClFN6O7PS and a molecular weight of 604.99 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-chloro-3-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-chloro-3-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 137058153 |
| Molecular Formula | C22H27ClFN6O7PS |
| Molecular Weight | 604.99 g/mol |
| Exact Mass | 604.11 |
| IUPAC Name | propan-2-yl 2-[[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-chloro-3-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=S)(OCC1OC(n2cnc3c(=O)[nH]c(N)nc32)C(Cl)C1(O)F)Oc1ccccc1 |
| InChI | InChI=1S/C22H27ClFN6O7PS/c1-11(2)35-20(32)12(3)29-38(39,37-13-7-5-4-6-8-13)34-9-14-22(24,33)16(23)19(36-14)30-10-26-15-17(30)27-21(25)28-18(15)31/h4-8,10-12,14,16,19,33H,9H2,1-3H3,(H,29,39)(H3,25,27,28,31) |
| InChIKey | XDDFXNOHOTVFDF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 175.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.99 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|