C22H15BrClN5O4S — CID 137058437
2-[[5-(5-bromo-2-hydroxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide (PubChem CID 137058437) has the molecular formula C22H15BrClN5O4S and a molecular weight of 560.82 g/mol. Its IUPAC name is 2-[[5-(5-bromo-2-hydroxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(5-bromo-2-hydroxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 137058437 |
| Molecular Formula | C22H15BrClN5O4S |
| Molecular Weight | 560.82 g/mol |
| Exact Mass | 558.97 |
| IUPAC Name | 2-[[5-(5-bromo-2-hydroxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nnc(-c2cc(Br)ccc2O)n1-c1ccccc1)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C22H15BrClN5O4S/c23-13-6-9-19(30)16(10-13)21-26-27-22(28(21)14-4-2-1-3-5-14)34-12-20(31)25-18-11-15(29(32)33)7-8-17(18)24/h1-11,30H,12H2,(H,25,31) |
| InChIKey | KEODHBOBQCHZHQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.82 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|