C23H15Cl2N3O3S2 — CID 137059548
(5E)-5-[[5-[(2,4-dichlorophenyl)diazenyl]-2-hydroxyphenyl]methylidene]-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 137059548) has the molecular formula C23H15Cl2N3O3S2 and a molecular weight of 516.43 g/mol. Its IUPAC name is (5E)-5-[[5-[(2,4-dichlorophenyl)diazenyl]-2-hydroxyphenyl]methylidene]-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[5-[(2,4-dichlorophenyl)diazenyl]-2-hydroxyphenyl]methylidene]-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137059548 |
| Molecular Formula | C23H15Cl2N3O3S2 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 514.99 |
| IUPAC Name | (5E)-5-[[5-[(2,4-dichlorophenyl)diazenyl]-2-hydroxyphenyl]methylidene]-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)/C(=C\c3cc(/N=N/c4ccc(Cl)cc4Cl)ccc3O)SC2=S)cc1 |
| InChI | InChI=1S/C23H15Cl2N3O3S2/c1-31-17-6-4-16(5-7-17)28-22(30)21(33-23(28)32)11-13-10-15(3-9-20(13)29)26-27-19-8-2-14(24)12-18(19)25/h2-12,29H,1H3/b21-11+,27-26+ |
| InChIKey | FNEMYVIRWUFLMP-GMEOSHFQSA-N |
| XLogP | 7.53 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|