C26H22ClN5O2 — CID 137060446
4-[[(11E)-5-chloro-9,18-dioxo-8,17,20,21-tetrazatetracyclo[17.2.1.02,7.015,20]docosa-1(21),2(7),3,5,11,19(22)-hexaen-17-yl]methyl]benzonitrile (PubChem CID 137060446) has the molecular formula C26H22ClN5O2 and a molecular weight of 471.95 g/mol. Its IUPAC name is 4-[[(11E)-5-chloro-9,18-dioxo-8,17,20,21-tetrazatetracyclo[17.2.1.02,7.015,20]docosa-1(21),2(7),3,5,11,19(22)-hexaen-17-yl]methyl]benzonitrile.
| Compound Name | 4-[[(11E)-5-chloro-9,18-dioxo-8,17,20,21-tetrazatetracyclo[17.2.1.02,7.015,20]docosa-1(21),2(7),3,5,11,19(22)-hexaen-17-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 137060446 |
| Molecular Formula | C26H22ClN5O2 |
| Molecular Weight | 471.95 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 4-[[(11E)-5-chloro-9,18-dioxo-8,17,20,21-tetrazatetracyclo[17.2.1.02,7.015,20]docosa-1(21),2(7),3,5,11,19(22)-hexaen-17-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CC3CC/C=C/CC(=O)Nc4cc(Cl)ccc4-c4cc(n3n4)C2=O)cc1 |
| InChI | InChI=1S/C26H22ClN5O2/c27-19-10-11-21-22(12-19)29-25(33)5-3-1-2-4-20-16-31(15-18-8-6-17(14-28)7-9-18)26(34)24-13-23(21)30-32(20)24/h1,3,6-13,20H,2,4-5,15-16H2,(H,29,33)/b3-1+ |
| InChIKey | ZQQGPENJVNJIIM-HNQUOIGGSA-N |
| XLogP | 4.95 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.95 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|