C19H18N7O6- — CID 137061590
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-8-ium-6-yl)methylamino]benzoyl]amino]pentanedioate (PubChem CID 137061590) has the molecular formula C19H18N7O6- and a molecular weight of 440.40 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-8-ium-6-yl)methylamino]benzoyl]amino]pentanedioate.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-8-ium-6-yl)methylamino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 137061590 |
| Molecular Formula | C19H18N7O6- |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-8-ium-6-yl)methylamino]benzoyl]amino]pentanedioate |
| SMILES | Nc1nc2[nH+]cc(CNc3ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/p-1/t12-/m0/s1 |
| InChIKey | OVBPIULPVIDEAO-LBPRGKRZSA-M |
| XLogP | -3.30 |
| TPSA | 220.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |