About (7aR)-3-methyl-1,7a-dihydroindazol-5-imine
(7aR)-3-methyl-1,7a-dihydroindazol-5-imine (PubChem CID 137061735) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is (7aR)-3-methyl-1,7a-dihydroindazol-5-imine.
Molecular Properties
| Compound Name | (7aR)-3-methyl-1,7a-dihydroindazol-5-imine |
| PubChem CID | 137061735 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | (7aR)-3-methyl-1,7a-dihydroindazol-5-imine |
| SMILES | [H]/N=C1\C=C[C@H]2NN=C(C)C2=C1 |
| InChI | InChI=1S/C8H9N3/c1-5-7-4-6(9)2-3-8(7)11-10-5/h2-4,8-9,11H,1H3/b9-6+/t8-/m1/s1 |
| InChIKey | ZJSXXNAPMFGKMF-GTUWVTDSSA-N |
| XLogP | 0.85 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (7aR)-3-methyl-1,7a-dihydroindazol-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7aR)-3-methyl-1,7a-dihydroindazol-5-imine?
The IUPAC name of (7aR)-3-methyl-1,7a-dihydroindazol-5-imine (CID 137061735) is (7aR)-3-methyl-1,7a-dihydroindazol-5-imine.
What is the SMILES notation for (7aR)-3-methyl-1,7a-dihydroindazol-5-imine?
The canonical SMILES for (7aR)-3-methyl-1,7a-dihydroindazol-5-imine is [H]/N=C1\C=C[C@H]2NN=C(C)C2=C1.
What is the InChIKey of (7aR)-3-methyl-1,7a-dihydroindazol-5-imine?
The InChIKey is ZJSXXNAPMFGKMF-GTUWVTDSSA-N. The full InChI is InChI=1S/C8H9N3/c1-5-7-4-6(9)2-3-8(7)11-10-5/h2-4,8-9,11H,1H3/b9-6+/t8-/m1/s1.
What are the key properties of (7aR)-3-methyl-1,7a-dihydroindazol-5-imine?
(7aR)-3-methyl-1,7a-dihydroindazol-5-imine has a molecular weight of 147.18 g/mol, XLogP of 0.85, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7aR)-3-methyl-1,7a-dihydroindazol-5-imine is sourced from PubChem (CID 137061735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).