About [[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium
[[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium (PubChem CID 137062053) has the molecular formula C13H24N5+
and a molecular weight of 250.37 g/mol. Its IUPAC name is [[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium.
Molecular Properties
| Compound Name | [[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium |
| PubChem CID | 137062053 |
| Molecular Formula | C13H24N5+ |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | [[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium |
| SMILES | C=NC(=C1NC=N/C1=N\CC(C)(C)C)[N+](C)(C)C |
| InChI | InChI=1S/C13H24N5/c1-13(2,3)8-15-11-10(16-9-17-11)12(14-4)18(5,6)7/h9H,4,8H2,1-3,5-7H3,(H,15,16,17)/q+1 |
| InChIKey | ZQTSPOKGNGZBLQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium?
The IUPAC name of [[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium (CID 137062053) is [[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium.
What is the SMILES notation for [[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium?
The canonical SMILES for [[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium is C=NC(=C1NC=N/C1=N\CC(C)(C)C)[N+](C)(C)C.
What is the InChIKey of [[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium?
The InChIKey is ZQTSPOKGNGZBLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N5/c1-13(2,3)8-15-11-10(16-9-17-11)12(14-4)18(5,6)7/h9H,4,8H2,1-3,5-7H3,(H,15,16,17)/q+1.
What are the key properties of [[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium?
[[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium has a molecular weight of 250.37 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[4-(2,2-dimethylpropylimino)-1H-imidazol-5-ylidene]-(methylideneamino)methyl]-trimethylazanium is sourced from PubChem (CID 137062053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).