About 2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine
2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine (PubChem CID 137062103) has the molecular formula C14H14F3N5O
and a molecular weight of 325.29 g/mol. Its IUPAC name is 2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine |
| PubChem CID | 137062103 |
| Molecular Formula | C14H14F3N5O |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine |
| SMILES | COCCCn1nccc1-c1nc2cc(C(F)(F)F)ncc2[nH]1 |
| InChI | InChI=1S/C14H14F3N5O/c1-23-6-2-5-22-11(3-4-19-22)13-20-9-7-12(14(15,16)17)18-8-10(9)21-13/h3-4,7-8H,2,5-6H2,1H3,(H,20,21) |
| InChIKey | XWLBYYZEPXZSQD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine?
The IUPAC name of 2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine (CID 137062103) is 2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine.
What is the SMILES notation for 2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine?
The canonical SMILES for 2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine is COCCCn1nccc1-c1nc2cc(C(F)(F)F)ncc2[nH]1.
What is the InChIKey of 2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine?
The InChIKey is XWLBYYZEPXZSQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3N5O/c1-23-6-2-5-22-11(3-4-19-22)13-20-9-7-12(14(15,16)17)18-8-10(9)21-13/h3-4,7-8H,2,5-6H2,1H3,(H,20,21).
What are the key properties of 2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine?
2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine has a molecular weight of 325.29 g/mol, XLogP of 2.88, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-methoxypropyl)pyrazol-3-yl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine is sourced from PubChem (CID 137062103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).