C19H21F3N6O3S — CID 137064397
3-[(5-methyl-1H-1,2,4-triazol-3-yl)methylidene]-4-[[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]sulfonyl]-1H-indol-2-one (PubChem CID 137064397) has the molecular formula C19H21F3N6O3S and a molecular weight of 470.48 g/mol. Its IUPAC name is 3-[(5-methyl-1H-1,2,4-triazol-3-yl)methylidene]-4-[[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]sulfonyl]-1H-indol-2-one.
| Compound Name | 3-[(5-methyl-1H-1,2,4-triazol-3-yl)methylidene]-4-[[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]sulfonyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 137064397 |
| Molecular Formula | C19H21F3N6O3S |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 3-[(5-methyl-1H-1,2,4-triazol-3-yl)methylidene]-4-[[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]sulfonyl]-1H-indol-2-one |
| SMILES | Cc1nc(C=C2C(=O)Nc3cccc(S(=O)(=O)N4CCCN(CC(F)(F)F)CC4)c32)n[nH]1 |
| InChI | InChI=1S/C19H21F3N6O3S/c1-12-23-16(26-25-12)10-13-17-14(24-18(13)29)4-2-5-15(17)32(30,31)28-7-3-6-27(8-9-28)11-19(20,21)22/h2,4-5,10H,3,6-9,11H2,1H3,(H,24,29)(H,23,25,26) |
| InChIKey | OTXHVBJQBRLEHZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|