C17H15BrN2O2S2 — CID 137065323
5-[(5-bromoindol-3-ylidene)methyl]-4-hydroxy-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazole-2-thione (PubChem CID 137065323) has the molecular formula C17H15BrN2O2S2 and a molecular weight of 423.36 g/mol. Its IUPAC name is 5-[(5-bromoindol-3-ylidene)methyl]-4-hydroxy-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazole-2-thione.
| Compound Name | 5-[(5-bromoindol-3-ylidene)methyl]-4-hydroxy-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 137065323 |
| Molecular Formula | C17H15BrN2O2S2 |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | 5-[(5-bromoindol-3-ylidene)methyl]-4-hydroxy-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazole-2-thione |
| SMILES | Oc1c(C=C2C=Nc3ccc(Br)cc32)sc(=S)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H15BrN2O2S2/c18-11-3-4-14-13(7-11)10(8-19-14)6-15-16(21)20(17(23)24-15)9-12-2-1-5-22-12/h3-4,6-8,12,21H,1-2,5,9H2/t12-/m0/s1 |
| InChIKey | BKJOIEDLXALWMT-LBPRGKRZSA-N |
| XLogP | 5.18 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|