C26H23N3O4 — CID 137065534
4-[[4-[(3aR,4R,9bS)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]iminomethyl]-2-methoxy-6-nitrophenol (PubChem CID 137065534) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 4-[[4-[(3aR,4R,9bS)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]iminomethyl]-2-methoxy-6-nitrophenol.
| Compound Name | 4-[[4-[(3aR,4R,9bS)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]iminomethyl]-2-methoxy-6-nitrophenol |
|---|---|
| PubChem CID | 137065534 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 4-[[4-[(3aR,4R,9bS)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]iminomethyl]-2-methoxy-6-nitrophenol |
| SMILES | COc1cc(/C=N/c2ccc([C@@H]3Nc4ccccc4[C@H]4C=CC[C@H]43)cc2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C26H23N3O4/c1-33-24-14-16(13-23(26(24)30)29(31)32)15-27-18-11-9-17(10-12-18)25-21-7-4-6-19(21)20-5-2-3-8-22(20)28-25/h2-6,8-15,19,21,25,28,30H,7H2,1H3/b27-15+/t19-,21-,25+/m1/s1 |
| InChIKey | RCBYDLLMIQRFFW-JDTUQCDQSA-N |
| XLogP | 5.89 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|