C11H17N5O — CID 137066531
2-amino-5-(butylaminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 137066531) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-amino-5-(butylaminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-5-(butylaminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137066531 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-amino-5-(butylaminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCCNCc1c[nH]c2nc(N)[nH]c(=O)c12 |
| InChI | InChI=1S/C11H17N5O/c1-2-3-4-13-5-7-6-14-9-8(7)10(17)16-11(12)15-9/h6,13H,2-5H2,1H3,(H4,12,14,15,16,17) |
| InChIKey | QTUKEYORKMKFGQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|