About [6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate
[6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate (PubChem CID 137066597) has the molecular formula C19H21N5O3
and a molecular weight of 367.41 g/mol. Its IUPAC name is [6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate.
Molecular Properties
| Compound Name | [6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate |
| PubChem CID | 137066597 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate |
| SMILES | NC1CCCC(NC(=O)Oc2cc(-c3ccc(O)cc3)nc3[nH]ncc23)C1 |
| InChI | InChI=1S/C19H21N5O3/c20-12-2-1-3-13(8-12)22-19(26)27-17-9-16(11-4-6-14(25)7-5-11)23-18-15(17)10-21-24-18/h4-7,9-10,12-13,25H,1-3,8,20H2,(H,22,26)(H,21,23,24) |
| InChIKey | NTAOUNAXJZXPCA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate?
The IUPAC name of [6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate (CID 137066597) is [6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate.
What is the SMILES notation for [6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate?
The canonical SMILES for [6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate is NC1CCCC(NC(=O)Oc2cc(-c3ccc(O)cc3)nc3[nH]ncc23)C1.
What is the InChIKey of [6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate?
The InChIKey is NTAOUNAXJZXPCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O3/c20-12-2-1-3-13(8-12)22-19(26)27-17-9-16(11-4-6-14(25)7-5-11)23-18-15(17)10-21-24-18/h4-7,9-10,12-13,25H,1-3,8,20H2,(H,22,26)(H,21,23,24).
What are the key properties of [6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate?
[6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate has a molecular weight of 367.41 g/mol, XLogP of 2.69, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4-hydroxyphenyl)-1H-pyrazolo[5,4-b]pyridin-4-yl] N-(3-aminocyclohexyl)carbamate is sourced from PubChem (CID 137066597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).