C28H24Cl2N4O4 — CID 137066721
methyl (7R)-7-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 137066721) has the molecular formula C28H24Cl2N4O4 and a molecular weight of 551.43 g/mol. Its IUPAC name is methyl (7R)-7-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | methyl (7R)-7-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 137066721 |
| Molecular Formula | C28H24Cl2N4O4 |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | methyl (7R)-7-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOc1cc([C@@H]2C(C(=O)OC)=C(c3ccccc3)Nc3ncnn32)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H24Cl2N4O4/c1-3-37-23-14-19(10-12-22(23)38-15-17-9-11-20(29)21(30)13-17)26-24(27(35)36-2)25(18-7-5-4-6-8-18)33-28-31-16-32-34(26)28/h4-14,16,26H,3,15H2,1-2H3,(H,31,32,33)/t26-/m1/s1 |
| InChIKey | CXZWSDHNAQWTTN-AREMUKBSSA-N |
| XLogP | 6.16 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |