C13H18BrN3O3S2 — CID 137067619
[(4aR,8aR)-8a-(4-bromo-1,3-thiazol-2-yl)-6-(hydroxymethyl)-2-methylimino-4,4a,5,8-tetrahydro-1H-pyrano[3,4-d][1,3]thiazin-6-yl]methanol (PubChem CID 137067619) has the molecular formula C13H18BrN3O3S2 and a molecular weight of 408.34 g/mol. Its IUPAC name is [(4aR,8aR)-8a-(4-bromo-1,3-thiazol-2-yl)-6-(hydroxymethyl)-2-methylimino-4,4a,5,8-tetrahydro-1H-pyrano[3,4-d][1,3]thiazin-6-yl]methanol.
| Compound Name | [(4aR,8aR)-8a-(4-bromo-1,3-thiazol-2-yl)-6-(hydroxymethyl)-2-methylimino-4,4a,5,8-tetrahydro-1H-pyrano[3,4-d][1,3]thiazin-6-yl]methanol |
|---|---|
| PubChem CID | 137067619 |
| Molecular Formula | C13H18BrN3O3S2 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | [(4aR,8aR)-8a-(4-bromo-1,3-thiazol-2-yl)-6-(hydroxymethyl)-2-methylimino-4,4a,5,8-tetrahydro-1H-pyrano[3,4-d][1,3]thiazin-6-yl]methanol |
| SMILES | C/N=C1/N[C@@]2(c3nc(Br)cs3)COC(CO)(CO)C[C@H]2CS1 |
| InChI | InChI=1S/C13H18BrN3O3S2/c1-15-11-17-13(10-16-9(14)4-21-10)7-20-12(5-18,6-19)2-8(13)3-22-11/h4,8,18-19H,2-3,5-7H2,1H3,(H,15,17)/t8-,13-/m0/s1 |
| InChIKey | LDSGZLRGRZDZDG-SDBXPKJASA-N |
| XLogP | 1.18 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|