C12H16BrN3O2S2 — CID 137067621
[(4aR,6R,8aR)-8a-(4-bromo-1,3-thiazol-2-yl)-2-methylimino-1,4,4a,5,6,8-hexahydropyrano[3,4-d][1,3]thiazin-6-yl]methanol (PubChem CID 137067621) has the molecular formula C12H16BrN3O2S2 and a molecular weight of 378.32 g/mol. Its IUPAC name is [(4aR,6R,8aR)-8a-(4-bromo-1,3-thiazol-2-yl)-2-methylimino-1,4,4a,5,6,8-hexahydropyrano[3,4-d][1,3]thiazin-6-yl]methanol.
| Compound Name | [(4aR,6R,8aR)-8a-(4-bromo-1,3-thiazol-2-yl)-2-methylimino-1,4,4a,5,6,8-hexahydropyrano[3,4-d][1,3]thiazin-6-yl]methanol |
|---|---|
| PubChem CID | 137067621 |
| Molecular Formula | C12H16BrN3O2S2 |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | [(4aR,6R,8aR)-8a-(4-bromo-1,3-thiazol-2-yl)-2-methylimino-1,4,4a,5,6,8-hexahydropyrano[3,4-d][1,3]thiazin-6-yl]methanol |
| SMILES | C/N=C1/N[C@@]2(c3nc(Br)cs3)CO[C@@H](CO)C[C@H]2CS1 |
| InChI | InChI=1S/C12H16BrN3O2S2/c1-14-11-16-12(10-15-9(13)5-19-10)6-18-8(3-17)2-7(12)4-20-11/h5,7-8,17H,2-4,6H2,1H3,(H,14,16)/t7-,8+,12-/m0/s1 |
| InChIKey | VNLPXWWUUWIKFS-SXMVTHIZSA-N |
| XLogP | 1.82 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|