C13H11NO5 — CID 137067676
5-(2,6-dimethyl-4-pyridinyl)-3,6-dihydroxycyclohex-5-ene-1,2,4-trione (PubChem CID 137067676) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is 5-(2,6-dimethyl-4-pyridinyl)-3,6-dihydroxycyclohex-5-ene-1,2,4-trione.
| Compound Name | 5-(2,6-dimethyl-4-pyridinyl)-3,6-dihydroxycyclohex-5-ene-1,2,4-trione |
|---|---|
| PubChem CID | 137067676 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 5-(2,6-dimethyl-4-pyridinyl)-3,6-dihydroxycyclohex-5-ene-1,2,4-trione |
| SMILES | Cc1cc(C2=C(O)C(=O)C(=O)C(O)C2=O)cc(C)n1 |
| InChI | InChI=1S/C13H11NO5/c1-5-3-7(4-6(2)14-5)8-9(15)11(17)13(19)12(18)10(8)16/h3-4,11,16-17H,1-2H3 |
| InChIKey | LXRPLXVIKCIITB-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|