C26H21FN4O5 — CID 137067956
[3-(3-carboxyphenyl)-5-fluoro-2-hydroxyphenyl]-[[2-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]imino]-oxidoazanium (PubChem CID 137067956) has the molecular formula C26H21FN4O5 and a molecular weight of 488.48 g/mol. Its IUPAC name is [3-(3-carboxyphenyl)-5-fluoro-2-hydroxyphenyl]-[[2-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]imino]-oxidoazanium.
| Compound Name | [3-(3-carboxyphenyl)-5-fluoro-2-hydroxyphenyl]-[[2-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]imino]-oxidoazanium |
|---|---|
| PubChem CID | 137067956 |
| Molecular Formula | C26H21FN4O5 |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | [3-(3-carboxyphenyl)-5-fluoro-2-hydroxyphenyl]-[[2-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]imino]-oxidoazanium |
| SMILES | Cc1[nH]n(-c2ccc3c(c2)CCC3)c(=O)c1/N=[N+](\[O-])c1cc(F)cc(-c2cccc(C(=O)O)c2)c1O |
| InChI | InChI=1S/C26H21FN4O5/c1-14-23(25(33)30(28-14)20-9-8-15-4-2-5-16(15)11-20)29-31(36)22-13-19(27)12-21(24(22)32)17-6-3-7-18(10-17)26(34)35/h3,6-13,28,32H,2,4-5H2,1H3,(H,34,35)/b31-29- |
| InChIKey | IQFMGWRIRKNKDI-YCNYHXFESA-N |
| XLogP | 5.10 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|