C19H11ClF3N3O3S — CID 137068346
5-[2-[4-chloro-2-(trifluoromethyl)phenyl]-1-indazol-5-ylideneethyl]-3,4-dihydroxy-1,3-thiazol-2-one (PubChem CID 137068346) has the molecular formula C19H11ClF3N3O3S and a molecular weight of 453.83 g/mol. Its IUPAC name is 5-[2-[4-chloro-2-(trifluoromethyl)phenyl]-1-indazol-5-ylideneethyl]-3,4-dihydroxy-1,3-thiazol-2-one.
| Compound Name | 5-[2-[4-chloro-2-(trifluoromethyl)phenyl]-1-indazol-5-ylideneethyl]-3,4-dihydroxy-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 137068346 |
| Molecular Formula | C19H11ClF3N3O3S |
| Molecular Weight | 453.83 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | 5-[2-[4-chloro-2-(trifluoromethyl)phenyl]-1-indazol-5-ylideneethyl]-3,4-dihydroxy-1,3-thiazol-2-one |
| SMILES | O=c1sc(C(Cc2ccc(Cl)cc2C(F)(F)F)=c2ccc3c(c2)C=NN=3)c(O)n1O |
| InChI | InChI=1S/C19H11ClF3N3O3S/c20-12-3-1-10(14(7-12)19(21,22)23)6-13(16-17(27)26(29)18(28)30-16)9-2-4-15-11(5-9)8-24-25-15/h1-5,7-8,27,29H,6H2 |
| InChIKey | MAVRNNDHUOWQFM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 87.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.83 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|