C21H22N2O4 — CID 137068714
(1S,2R,6R,7S,8R,10R)-4-[(Z)-(2-hydroxy-4-propan-2-yloxyphenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 137068714) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R,10R)-4-[(Z)-(2-hydroxy-4-propan-2-yloxyphenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S,8R,10R)-4-[(Z)-(2-hydroxy-4-propan-2-yloxyphenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 137068714 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (1S,2R,6R,7S,8R,10R)-4-[(Z)-(2-hydroxy-4-propan-2-yloxyphenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | CC(C)Oc1ccc(/C=N\N2C(=O)[C@@H]3[C@H]4C=C[C@@H]([C@@H]5C[C@@H]45)[C@H]3C2=O)c(O)c1 |
| InChI | InChI=1S/C21H22N2O4/c1-10(2)27-12-4-3-11(17(24)7-12)9-22-23-20(25)18-13-5-6-14(16-8-15(13)16)19(18)21(23)26/h3-7,9-10,13-16,18-19,24H,8H2,1-2H3/b22-9-/t13-,14-,15-,16-,18+,19+/m0/s1 |
| InChIKey | DBYUGWQZRAKSPL-LFZXKCLQSA-N |
| XLogP | 2.57 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|