About 5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one
5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one (PubChem CID 137069232) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one.
Molecular Properties
| Compound Name | 5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one |
| PubChem CID | 137069232 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one |
| SMILES | O=C1CCN=C1c1[nH]ccc1O |
| InChI | InChI=1S/C8H8N2O2/c11-5-1-3-9-7(5)8-6(12)2-4-10-8/h1,3,9,11H,2,4H2 |
| InChIKey | FCURNSRWEINVNB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one?
The IUPAC name of 5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one (CID 137069232) is 5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one.
What is the SMILES notation for 5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one?
The canonical SMILES for 5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one is O=C1CCN=C1c1[nH]ccc1O.
What is the InChIKey of 5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one?
The InChIKey is FCURNSRWEINVNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c11-5-1-3-9-7(5)8-6(12)2-4-10-8/h1,3,9,11H,2,4H2.
What are the key properties of 5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one?
5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one has a molecular weight of 164.16 g/mol, XLogP of 0.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-hydroxy-1H-pyrrol-2-yl)-2,3-dihydropyrrol-4-one is sourced from PubChem (CID 137069232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).