C20H20BrN3O — CID 137070669
2-(4-bromo-2-methylphenyl)-4-[(2,3-dimethylphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 137070669) has the molecular formula C20H20BrN3O and a molecular weight of 398.30 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)-4-[(2,3-dimethylphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-bromo-2-methylphenyl)-4-[(2,3-dimethylphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137070669 |
| Molecular Formula | C20H20BrN3O |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)-4-[(2,3-dimethylphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1cc(Br)ccc1-n1[nH]c(C)c(/C=N/c2cccc(C)c2C)c1=O |
| InChI | InChI=1S/C20H20BrN3O/c1-12-6-5-7-18(14(12)3)22-11-17-15(4)23-24(20(17)25)19-9-8-16(21)10-13(19)2/h5-11,23H,1-4H3/b22-11+ |
| InChIKey | PCPWLHFNZIMPLR-SSDVNMTOSA-N |
| XLogP | 4.91 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|