C32H32N4O6S — CID 137070742
ethyl 2-[[4-[[6-hydroxy-2,4-dioxo-1-(2,4,6-trimethylphenyl)pyrimidin-5-yl]methylideneamino]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 137070742) has the molecular formula C32H32N4O6S and a molecular weight of 600.70 g/mol. Its IUPAC name is ethyl 2-[[4-[[6-hydroxy-2,4-dioxo-1-(2,4,6-trimethylphenyl)pyrimidin-5-yl]methylideneamino]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-[[6-hydroxy-2,4-dioxo-1-(2,4,6-trimethylphenyl)pyrimidin-5-yl]methylideneamino]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137070742 |
| Molecular Formula | C32H32N4O6S |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | ethyl 2-[[4-[[6-hydroxy-2,4-dioxo-1-(2,4,6-trimethylphenyl)pyrimidin-5-yl]methylideneamino]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(/N=C/c3c(O)n(-c4c(C)cc(C)cc4C)c(=O)[nH]c3=O)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C32H32N4O6S/c1-5-42-31(40)25-22-8-6-7-9-24(22)43-29(25)34-27(37)20-10-12-21(13-11-20)33-16-23-28(38)35-32(41)36(30(23)39)26-18(3)14-17(2)15-19(26)4/h10-16,39H,5-9H2,1-4H3,(H,34,37)(H,35,38,41)/b33-16+ |
| InChIKey | RXYAUXNPDXAWLR-MHDJOFBISA-N |
| XLogP | 5.28 |
| TPSA | 142.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|