C17H11BrN4O3S — CID 137071222
2-[[5-(5-bromo-2-hydroxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione (PubChem CID 137071222) has the molecular formula C17H11BrN4O3S and a molecular weight of 431.27 g/mol. Its IUPAC name is 2-[[5-(5-bromo-2-hydroxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-(5-bromo-2-hydroxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 137071222 |
| Molecular Formula | C17H11BrN4O3S |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | 2-[[5-(5-bromo-2-hydroxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CSc1n[nH]c(-c2cc(Br)ccc2O)n1 |
| InChI | InChI=1S/C17H11BrN4O3S/c18-9-5-6-13(23)12(7-9)14-19-17(21-20-14)26-8-22-15(24)10-3-1-2-4-11(10)16(22)25/h1-7,23H,8H2,(H,19,20,21) |
| InChIKey | PECPNWUFHGGEFD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|