About 4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine
4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine (PubChem CID 137071451) has the molecular formula C18H22N4O
and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine.
Molecular Properties
| Compound Name | 4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine |
| PubChem CID | 137071451 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine |
| SMILES | CCOC1=N/C(=N/c2cccnc2)CCc2[nH]c(CC)c(C)c21 |
| InChI | InChI=1S/C18H22N4O/c1-4-14-12(3)17-15(21-14)8-9-16(22-18(17)23-5-2)20-13-7-6-10-19-11-13/h6-7,10-11,21H,4-5,8-9H2,1-3H3/b20-16+ |
| InChIKey | CKBGBKFCBADPCE-CAPFRKAQSA-N |
| XLogP | 3.74 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine?
The IUPAC name of 4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine (CID 137071451) is 4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine.
What is the SMILES notation for 4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine?
The canonical SMILES for 4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine is CCOC1=N/C(=N/c2cccnc2)CCc2[nH]c(CC)c(C)c21.
What is the InChIKey of 4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine?
The InChIKey is CKBGBKFCBADPCE-CAPFRKAQSA-N. The full InChI is InChI=1S/C18H22N4O/c1-4-14-12(3)17-15(21-14)8-9-16(22-18(17)23-5-2)20-13-7-6-10-19-11-13/h6-7,10-11,21H,4-5,8-9H2,1-3H3/b20-16+.
What are the key properties of 4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine?
4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine has a molecular weight of 310.40 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-2-ethyl-3-methyl-N-pyridin-3-yl-7,8-dihydro-1H-pyrrolo[3,2-c]azepin-6-imine is sourced from PubChem (CID 137071451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).