C26H33N3O2S — CID 137071470
2-[(1,3-dimethyl-4H-cyclohepta[b]pyrrol-6-yl)methyl]-N-[1-(5-ethyl-2,4-dihydroxyphenyl)ethylideneamino]butanethioamide (PubChem CID 137071470) has the molecular formula C26H33N3O2S and a molecular weight of 451.64 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-4H-cyclohepta[b]pyrrol-6-yl)methyl]-N-[1-(5-ethyl-2,4-dihydroxyphenyl)ethylideneamino]butanethioamide.
| Compound Name | 2-[(1,3-dimethyl-4H-cyclohepta[b]pyrrol-6-yl)methyl]-N-[1-(5-ethyl-2,4-dihydroxyphenyl)ethylideneamino]butanethioamide |
|---|---|
| PubChem CID | 137071470 |
| Molecular Formula | C26H33N3O2S |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 2-[(1,3-dimethyl-4H-cyclohepta[b]pyrrol-6-yl)methyl]-N-[1-(5-ethyl-2,4-dihydroxyphenyl)ethylideneamino]butanethioamide |
| SMILES | CCc1cc(C(C)=NNC(=S)C(CC)CC2=CCc3c(C)cn(C)c3C=C2)c(O)cc1O |
| InChI | InChI=1S/C26H33N3O2S/c1-6-19-13-22(25(31)14-24(19)30)17(4)27-28-26(32)20(7-2)12-18-8-10-21-16(3)15-29(5)23(21)11-9-18/h8-9,11,13-15,20,30-31H,6-7,10,12H2,1-5H3,(H,28,32) |
| InChIKey | YWKGHGNUYAHFTJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|