C27H12F6N2O2S2 — CID 137072221
6-hydroxy-5-methyl-1,4-bis[5-(3,4,5-trifluorophenyl)thiophen-2-yl]pyrrolo[3,4-c]pyrrol-3-one (PubChem CID 137072221) has the molecular formula C27H12F6N2O2S2 and a molecular weight of 574.53 g/mol. Its IUPAC name is 6-hydroxy-5-methyl-1,4-bis[5-(3,4,5-trifluorophenyl)thiophen-2-yl]pyrrolo[3,4-c]pyrrol-3-one.
| Compound Name | 6-hydroxy-5-methyl-1,4-bis[5-(3,4,5-trifluorophenyl)thiophen-2-yl]pyrrolo[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 137072221 |
| Molecular Formula | C27H12F6N2O2S2 |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 574.02 |
| IUPAC Name | 6-hydroxy-5-methyl-1,4-bis[5-(3,4,5-trifluorophenyl)thiophen-2-yl]pyrrolo[3,4-c]pyrrol-3-one |
| SMILES | Cn1c(O)c2c(c1-c1ccc(-c3cc(F)c(F)c(F)c3)s1)C(=O)N=C2c1ccc(-c2cc(F)c(F)c(F)c2)s1 |
| InChI | InChI=1S/C27H12F6N2O2S2/c1-35-25(19-5-3-17(39-19)11-8-14(30)23(33)15(31)9-11)21-20(27(35)37)24(34-26(21)36)18-4-2-16(38-18)10-6-12(28)22(32)13(29)7-10/h2-9,37H,1H3 |
| InChIKey | SNGFIUPHQNZWSB-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|