C7H8ClN3O3S — CID 137072291
4-chloro-2-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-5-nitro-1H-pyrimidin-6-one (PubChem CID 137072291) has the molecular formula C7H8ClN3O3S and a molecular weight of 256.72 g/mol. Its IUPAC name is 4-chloro-2-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 4-chloro-2-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137072291 |
| Molecular Formula | C7H8ClN3O3S |
| Molecular Weight | 256.72 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4-chloro-2-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-5-nitro-1H-pyrimidin-6-one |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])Sc1nc(Cl)c([N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C7H8ClN3O3S/c1-2-3-15-7-9-5(8)4(11(13)14)6(12)10-7/h2-3H2,1H3,(H,9,10,12)/i1D3,2D2,3D2 |
| InChIKey | GXBABSVBIPUOLI-NCKGIQLSSA-N |
| XLogP | 1.83 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.72 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|