About 6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide
6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide (PubChem CID 137072306) has the molecular formula C17H18Cl2N6OS
and a molecular weight of 425.35 g/mol. Its IUPAC name is 6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide.
Molecular Properties
| Compound Name | 6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide |
| PubChem CID | 137072306 |
| Molecular Formula | C17H18Cl2N6OS |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide |
| SMILES | [H]/N=c1\ncn(CCCCCC(N)=O)c2nc(Sc3cc(Cl)cc(Cl)c3)[nH]c12 |
| InChI | InChI=1S/C17H18Cl2N6OS/c18-10-6-11(19)8-12(7-10)27-17-23-14-15(21)22-9-25(16(14)24-17)5-3-1-2-4-13(20)26/h6-9,21H,1-5H2,(H2,20,26)(H,23,24)/b21-15- |
| InChIKey | SJWRHKHLXKVXOF-QNGOZBTKSA-N |
| XLogP | 3.74 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide?
The IUPAC name of 6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide (CID 137072306) is 6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide.
What is the SMILES notation for 6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide?
The canonical SMILES for 6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide is [H]/N=c1\ncn(CCCCCC(N)=O)c2nc(Sc3cc(Cl)cc(Cl)c3)[nH]c12.
What is the InChIKey of 6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide?
The InChIKey is SJWRHKHLXKVXOF-QNGOZBTKSA-N. The full InChI is InChI=1S/C17H18Cl2N6OS/c18-10-6-11(19)8-12(7-10)27-17-23-14-15(21)22-9-25(16(14)24-17)5-3-1-2-4-13(20)26/h6-9,21H,1-5H2,(H2,20,26)(H,23,24)/b21-15-.
What are the key properties of 6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide?
6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide has a molecular weight of 425.35 g/mol, XLogP of 3.74, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[8-(3,5-dichlorophenyl)sulfanyl-6-imino-7H-purin-3-yl]hexanamide is sourced from PubChem (CID 137072306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).