C21H27N3O3 — CID 137072594
(1S,10S)-13-[(4-ethoxy-3-methoxyphenyl)methyl]-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one (PubChem CID 137072594) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is (1S,10S)-13-[(4-ethoxy-3-methoxyphenyl)methyl]-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one.
| Compound Name | (1S,10S)-13-[(4-ethoxy-3-methoxyphenyl)methyl]-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
|---|---|
| PubChem CID | 137072594 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (1S,10S)-13-[(4-ethoxy-3-methoxyphenyl)methyl]-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
| SMILES | CCOc1ccc(CN2[C@H]3CC[C@H]2Cc2c(nc(C)[nH]c2=O)C3)cc1OC |
| InChI | InChI=1S/C21H27N3O3/c1-4-27-19-8-5-14(9-20(19)26-3)12-24-15-6-7-16(24)11-18-17(10-15)21(25)23-13(2)22-18/h5,8-9,15-16H,4,6-7,10-12H2,1-3H3,(H,22,23,25)/t15-,16-/m0/s1 |
| InChIKey | QUMSHCDLXSECGA-HOTGVXAUSA-N |
| XLogP | 2.62 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |