C19H17BrCl2N4O — CID 137073354
2-(4-bromo-2,3-dimethylphenyl)-4-[[(2,5-dichlorophenyl)hydrazinylidene]methyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 137073354) has the molecular formula C19H17BrCl2N4O and a molecular weight of 468.18 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dimethylphenyl)-4-[[(2,5-dichlorophenyl)hydrazinylidene]methyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-bromo-2,3-dimethylphenyl)-4-[[(2,5-dichlorophenyl)hydrazinylidene]methyl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137073354 |
| Molecular Formula | C19H17BrCl2N4O |
| Molecular Weight | 468.18 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | 2-(4-bromo-2,3-dimethylphenyl)-4-[[(2,5-dichlorophenyl)hydrazinylidene]methyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccc(Br)c(C)c2C)c(=O)c1C=NNc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H17BrCl2N4O/c1-10-11(2)18(7-5-15(10)20)26-19(27)14(12(3)25-26)9-23-24-17-8-13(21)4-6-16(17)22/h4-9,24-25H,1-3H3 |
| InChIKey | FMTQUNSBEWFQLA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.18 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|