C24H16Cl2N2O4S — CID 137073633
4-[[4-chloro-2-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 137073633) has the molecular formula C24H16Cl2N2O4S and a molecular weight of 499.38 g/mol. Its IUPAC name is 4-[[4-chloro-2-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-chloro-2-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 137073633 |
| Molecular Formula | C24H16Cl2N2O4S |
| Molecular Weight | 499.38 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | 4-[[4-chloro-2-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C1N/C(=N\c2ccc(Cl)cc2)S/C1=C\c1cc(Cl)ccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H16Cl2N2O4S/c25-17-5-8-19(9-6-17)27-24-28-22(29)21(33-24)12-16-11-18(26)7-10-20(16)32-13-14-1-3-15(4-2-14)23(30)31/h1-12H,13H2,(H,30,31)(H,27,28,29)/b21-12- |
| InChIKey | AYRPPSDPXWNTNX-MTJSOVHGSA-N |
| XLogP | 6.16 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.38 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|