About 4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine
4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine (PubChem CID 137078448) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is 4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine |
| PubChem CID | 137078448 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine |
| SMILES | [H]/N=C(\C)c1nc(CC)sc1N |
| InChI | InChI=1S/C7H11N3S/c1-3-5-10-6(4(2)8)7(9)11-5/h8H,3,9H2,1-2H3/b8-4+ |
| InChIKey | NIIRKLCBONPWFT-XBXARRHUSA-N |
| XLogP | 1.68 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine?
The IUPAC name of 4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine (CID 137078448) is 4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine.
What is the SMILES notation for 4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine?
The canonical SMILES for 4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine is [H]/N=C(\C)c1nc(CC)sc1N.
What is the InChIKey of 4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine?
The InChIKey is NIIRKLCBONPWFT-XBXARRHUSA-N. The full InChI is InChI=1S/C7H11N3S/c1-3-5-10-6(4(2)8)7(9)11-5/h8H,3,9H2,1-2H3/b8-4+.
What are the key properties of 4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine?
4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine has a molecular weight of 169.25 g/mol, XLogP of 1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethanimidoyl-2-ethyl-1,3-thiazol-5-amine is sourced from PubChem (CID 137078448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).