About methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate
methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate (PubChem CID 137078805) has the molecular formula C15H11Cl2F3N2O3
and a molecular weight of 395.16 g/mol. Its IUPAC name is methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate |
| PubChem CID | 137078805 |
| Molecular Formula | C15H11Cl2F3N2O3 |
| Molecular Weight | 395.16 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate |
| SMILES | COC(=O)Cc1nc(C(F)(F)F)c(Cc2ccc(Cl)c(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H11Cl2F3N2O3/c1-25-12(23)6-11-21-13(15(18,19)20)8(14(24)22-11)4-7-2-3-9(16)10(17)5-7/h2-3,5H,4,6H2,1H3,(H,21,22,24) |
| InChIKey | VHUYFMVRLXRRLW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.16 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate?
The IUPAC name of methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate (CID 137078805) is methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate.
What is the SMILES notation for methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate?
The canonical SMILES for methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate is COC(=O)Cc1nc(C(F)(F)F)c(Cc2ccc(Cl)c(Cl)c2)c(=O)[nH]1.
What is the InChIKey of methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate?
The InChIKey is VHUYFMVRLXRRLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2F3N2O3/c1-25-12(23)6-11-21-13(15(18,19)20)8(14(24)22-11)4-7-2-3-9(16)10(17)5-7/h2-3,5H,4,6H2,1H3,(H,21,22,24).
What are the key properties of methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate?
methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate has a molecular weight of 395.16 g/mol, XLogP of 3.40, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-[(3,4-dichlorophenyl)methyl]-6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]acetate is sourced from PubChem (CID 137078805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).