C34H33F5N6O3 — CID 137079155
2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[5-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]-2-pyridinyl]amino]pyrrolo[3,4-b]pyridin-5-ol (PubChem CID 137079155) has the molecular formula C34H33F5N6O3 and a molecular weight of 668.67 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[5-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]-2-pyridinyl]amino]pyrrolo[3,4-b]pyridin-5-ol.
| Compound Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[5-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]-2-pyridinyl]amino]pyrrolo[3,4-b]pyridin-5-ol |
|---|---|
| PubChem CID | 137079155 |
| Molecular Formula | C34H33F5N6O3 |
| Molecular Weight | 668.67 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[5-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]-2-pyridinyl]amino]pyrrolo[3,4-b]pyridin-5-ol |
| SMILES | COc1ccc(Cn2cc3nc(-c4c(F)cccc4F)cc(Nc4ccc(N5CCN(CCC(F)(F)F)CC5)cn4)c3c2O)c(OC)c1 |
| InChI | InChI=1S/C34H33F5N6O3/c1-47-23-8-6-21(29(16-23)48-2)19-45-20-28-32(33(45)46)27(17-26(41-28)31-24(35)4-3-5-25(31)36)42-30-9-7-22(18-40-30)44-14-12-43(13-15-44)11-10-34(37,38)39/h3-9,16-18,20,46H,10-15,19H2,1-2H3,(H,40,42) |
| InChIKey | DCEYOBOJSYSBNT-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.67 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |