C14H7BrClIN2O2S — CID 137079528
(5Z)-5-[(4-bromo-5-iodofuran-2-yl)methylidene]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137079528) has the molecular formula C14H7BrClIN2O2S and a molecular weight of 509.55 g/mol. Its IUPAC name is (5Z)-5-[(4-bromo-5-iodofuran-2-yl)methylidene]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-bromo-5-iodofuran-2-yl)methylidene]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137079528 |
| Molecular Formula | C14H7BrClIN2O2S |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 507.81 |
| IUPAC Name | (5Z)-5-[(4-bromo-5-iodofuran-2-yl)methylidene]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(Cl)cc2)S/C1=C\c1cc(Br)c(I)o1 |
| InChI | InChI=1S/C14H7BrClIN2O2S/c15-10-5-9(21-12(10)17)6-11-13(20)19-14(22-11)18-8-3-1-7(16)2-4-8/h1-6H,(H,18,19,20)/b11-6- |
| InChIKey | VZTSJBOWYBKVAR-WDZFZDKYSA-N |
| XLogP | 5.19 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|