C23H21ClN4OS — CID 137079600
(5Z)-2-(3-chloro-2-methylphenyl)imino-5-[[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137079600) has the molecular formula C23H21ClN4OS and a molecular weight of 436.97 g/mol. Its IUPAC name is (5Z)-2-(3-chloro-2-methylphenyl)imino-5-[[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3-chloro-2-methylphenyl)imino-5-[[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137079600 |
| Molecular Formula | C23H21ClN4OS |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | (5Z)-2-(3-chloro-2-methylphenyl)imino-5-[[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1c(Cl)cccc1/N=C1\NC(=O)/C(=C/c2cccn2-c2ccc(N(C)C)cc2)S1 |
| InChI | InChI=1S/C23H21ClN4OS/c1-15-19(24)7-4-8-20(15)25-23-26-22(29)21(30-23)14-18-6-5-13-28(18)17-11-9-16(10-12-17)27(2)3/h4-14H,1-3H3,(H,25,26,29)/b21-14- |
| InChIKey | XUQAODJDNZSDKS-STZFKDTASA-N |
| XLogP | 5.40 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|