C27H17Cl2FN2O2S — CID 137080793
(5E)-2-(2,3-dichlorophenyl)imino-5-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137080793) has the molecular formula C27H17Cl2FN2O2S and a molecular weight of 523.42 g/mol. Its IUPAC name is (5E)-2-(2,3-dichlorophenyl)imino-5-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2,3-dichlorophenyl)imino-5-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137080793 |
| Molecular Formula | C27H17Cl2FN2O2S |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | (5E)-2-(2,3-dichlorophenyl)imino-5-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2cccc(Cl)c2Cl)S/C1=C/c1c(OCc2ccc(F)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C27H17Cl2FN2O2S/c28-21-6-3-7-22(25(21)29)31-27-32-26(33)24(35-27)14-20-19-5-2-1-4-17(19)10-13-23(20)34-15-16-8-11-18(30)12-9-16/h1-14H,15H2,(H,31,32,33)/b24-14+ |
| InChIKey | XLXLFCJASOVAOW-ZVHZXABRSA-N |
| XLogP | 7.76 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|