C12H9FN4O — CID 137083655
11-fluoro-3,6,7,16-tetrazatetracyclo[11.2.1.05,15.09,14]hexadeca-5(15),6,9(14),10,12-pentaen-8-one (PubChem CID 137083655) has the molecular formula C12H9FN4O and a molecular weight of 244.23 g/mol. Its IUPAC name is 11-fluoro-3,6,7,16-tetrazatetracyclo[11.2.1.05,15.09,14]hexadeca-5(15),6,9(14),10,12-pentaen-8-one.
| Compound Name | 11-fluoro-3,6,7,16-tetrazatetracyclo[11.2.1.05,15.09,14]hexadeca-5(15),6,9(14),10,12-pentaen-8-one |
|---|---|
| PubChem CID | 137083655 |
| Molecular Formula | C12H9FN4O |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 11-fluoro-3,6,7,16-tetrazatetracyclo[11.2.1.05,15.09,14]hexadeca-5(15),6,9(14),10,12-pentaen-8-one |
| SMILES | O=c1nnc2c3c4c(cc(F)cc14)NC3CNC2 |
| InChI | InChI=1S/C12H9FN4O/c13-5-1-6-10-7(2-5)15-8-3-14-4-9(11(8)10)16-17-12(6)18/h1-2,8,14-15H,3-4H2 |
| InChIKey | PCKFHZDVRHKTIT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |